C20H32N4O2 — CID 111250675
N-[2-[[N-ethyl-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide (PubChem CID 111250675) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111250675 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]ethyl]cyclohexanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H32N4O2/c1-3-21-20(24-15-16-8-7-11-18(14-16)26-2)23-13-12-22-19(25)17-9-5-4-6-10-17/h7-8,11,14,17H,3-6,9-10,12-13,15H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | OKDZTBOZACPFGA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|