C24H30N4O3 — CID 111843698
N-[3-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 111843698) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 111843698 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[3-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCC2)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H30N4O3/c1-2-25-24(27-15-18-10-11-21-22(13-18)31-16-30-21)26-14-17-6-5-9-20(12-17)28-23(29)19-7-3-4-8-19/h5-6,9-13,19H,2-4,7-8,14-16H2,1H3,(H,28,29)(H2,25,26,27) |
| InChIKey | LHOOVWACBQFJDK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|