C25H33N3O2 — CID 134111473
1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 134111473) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 134111473 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | CC1CCCCC1N/C(=N\CC1CCCO1)Nc1cc(-c2ccccc2)ccc1O |
| InChI | InChI=1S/C25H33N3O2/c1-18-8-5-6-12-22(18)27-25(26-17-21-11-7-15-30-21)28-23-16-20(13-14-24(23)29)19-9-3-2-4-10-19/h2-4,9-10,13-14,16,18,21-22,29H,5-8,11-12,15,17H2,1H3,(H2,26,27,28) |
| InChIKey | FIMFCNCUNAUKER-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|