C24H31N3O4 — CID 134111510
methyl 4-hydroxy-3-[[N'-[2-(4-hydroxyphenyl)ethyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]benzoate (PubChem CID 134111510) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is methyl 4-hydroxy-3-[[N'-[2-(4-hydroxyphenyl)ethyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]benzoate.
| Compound Name | methyl 4-hydroxy-3-[[N'-[2-(4-hydroxyphenyl)ethyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 134111510 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | methyl 4-hydroxy-3-[[N'-[2-(4-hydroxyphenyl)ethyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(O)c(N/C(=N/CCc2ccc(O)cc2)NC2CCCCC2C)c1 |
| InChI | InChI=1S/C24H31N3O4/c1-16-5-3-4-6-20(16)26-24(25-14-13-17-7-10-19(28)11-8-17)27-21-15-18(23(30)31-2)9-12-22(21)29/h7-12,15-16,20,28-29H,3-6,13-14H2,1-2H3,(H2,25,26,27) |
| InChIKey | WKLUXPYOLCFLNC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|