C27H36N4O2 — CID 134111480
1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 134111480) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 134111480 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1-(2-hydroxy-5-phenylphenyl)-3-(2-methylcyclohexyl)-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CC1CCCCC1N/C(=N\CCCN1CCCC1=O)Nc1cc(-c2ccccc2)ccc1O |
| InChI | InChI=1S/C27H36N4O2/c1-20-9-5-6-12-23(20)29-27(28-16-8-18-31-17-7-13-26(31)33)30-24-19-22(14-15-25(24)32)21-10-3-2-4-11-21/h2-4,10-11,14-15,19-20,23,32H,5-9,12-13,16-18H2,1H3,(H2,28,29,30) |
| InChIKey | IBEVINIVDUIWAH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|