C19H27FN4O2 — CID 134099675
N-(5-fluoro-2-hydroxyphenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperidine-1-carboximidamide (PubChem CID 134099675) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(5-fluoro-2-hydroxyphenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | N-(5-fluoro-2-hydroxyphenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134099675 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-(5-fluoro-2-hydroxyphenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperidine-1-carboximidamide |
| SMILES | O=C1CCCN1CCC/N=C(/Nc1cc(F)ccc1O)N1CCCCC1 |
| InChI | InChI=1S/C19H27FN4O2/c20-15-7-8-17(25)16(14-15)22-19(24-10-2-1-3-11-24)21-9-5-13-23-12-4-6-18(23)26/h7-8,14,25H,1-6,9-13H2,(H,21,22) |
| InChIKey | VNLXXQGWZMDYNH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|