C24H30N4O — CID 111052747
N'-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-N-phenylpiperidine-1-carboximidamide (PubChem CID 111052747) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is N'-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111052747 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N'-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-N-phenylpiperidine-1-carboximidamide |
| SMILES | O=C1CCCN1Cc1cccc(C/N=C(\Nc2ccccc2)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H30N4O/c29-23-13-8-16-28(23)19-21-10-7-9-20(17-21)18-25-24(27-14-5-2-6-15-27)26-22-11-3-1-4-12-22/h1,3-4,7,9-12,17H,2,5-6,8,13-16,18-19H2,(H,25,26) |
| InChIKey | LINJOHKHSPXWMB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|