C22H28N4O — CID 111071160
3-[[[anilino(piperidin-1-yl)methylidene]amino]methyl]-N-ethylbenzamide (PubChem CID 111071160) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[[[anilino(piperidin-1-yl)methylidene]amino]methyl]-N-ethylbenzamide.
| Compound Name | 3-[[[anilino(piperidin-1-yl)methylidene]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 111071160 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 3-[[[anilino(piperidin-1-yl)methylidene]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\Nc2ccccc2)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H28N4O/c1-2-23-21(27)19-11-9-10-18(16-19)17-24-22(26-14-7-4-8-15-26)25-20-12-5-3-6-13-20/h3,5-6,9-13,16H,2,4,7-8,14-15,17H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | OEHSIUFVLSRRAI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|