C20H23BrFN3O — CID 134122035
2-[(5-bromo-2-fluorophenyl)methyl]-1-cyclohexyl-3-(3-hydroxyphenyl)guanidine (PubChem CID 134122035) has the molecular formula C20H23BrFN3O and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-1-cyclohexyl-3-(3-hydroxyphenyl)guanidine.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-cyclohexyl-3-(3-hydroxyphenyl)guanidine |
|---|---|
| PubChem CID | 134122035 |
| Molecular Formula | C20H23BrFN3O |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-cyclohexyl-3-(3-hydroxyphenyl)guanidine |
| SMILES | Oc1cccc(N/C(=N/Cc2cc(Br)ccc2F)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H23BrFN3O/c21-15-9-10-19(22)14(11-15)13-23-20(24-16-5-2-1-3-6-16)25-17-7-4-8-18(26)12-17/h4,7-12,16,26H,1-3,5-6,13H2,(H2,23,24,25) |
| InChIKey | XAXGOEDQMBRWJO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|