C21H27N3 — CID 3710493
1-cyclohexyl-2-[(4-methylphenyl)methyl]-3-phenylguanidine (PubChem CID 3710493) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4-methylphenyl)methyl]-3-phenylguanidine.
| Compound Name | 1-cyclohexyl-2-[(4-methylphenyl)methyl]-3-phenylguanidine |
|---|---|
| PubChem CID | 3710493 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-cyclohexyl-2-[(4-methylphenyl)methyl]-3-phenylguanidine |
| SMILES | Cc1ccc(C/N=C(\Nc2ccccc2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H27N3/c1-17-12-14-18(15-13-17)16-22-21(23-19-8-4-2-5-9-19)24-20-10-6-3-7-11-20/h2,4-5,8-9,12-15,20H,3,6-7,10-11,16H2,1H3,(H2,22,23,24) |
| InChIKey | WPAHFWSYRLCFQZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|