C22H28N4O — CID 111066149
N-cyclopropyl-4-[[N'-[(4-methylphenyl)methyl]-N-phenylcarbamimidoyl]amino]butanamide (PubChem CID 111066149) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N'-[(4-methylphenyl)methyl]-N-phenylcarbamimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N'-[(4-methylphenyl)methyl]-N-phenylcarbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111066149 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-cyclopropyl-4-[[N'-[(4-methylphenyl)methyl]-N-phenylcarbamimidoyl]amino]butanamide |
| SMILES | Cc1ccc(C/N=C(\NCCCC(=O)NC2CC2)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N4O/c1-17-9-11-18(12-10-17)16-24-22(26-19-6-3-2-4-7-19)23-15-5-8-21(27)25-20-13-14-20/h2-4,6-7,9-12,20H,5,8,13-16H2,1H3,(H,25,27)(H2,23,24,26) |
| InChIKey | DDFLQMGRGBOIMV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|