C21H27N3O2S — CID 109467712
1-[(1,1-dioxothian-4-yl)methyl]-2-[(4-methylphenyl)methyl]-3-phenylguanidine (PubChem CID 109467712) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)methyl]-2-[(4-methylphenyl)methyl]-3-phenylguanidine.
| Compound Name | 1-[(1,1-dioxothian-4-yl)methyl]-2-[(4-methylphenyl)methyl]-3-phenylguanidine |
|---|---|
| PubChem CID | 109467712 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)methyl]-2-[(4-methylphenyl)methyl]-3-phenylguanidine |
| SMILES | Cc1ccc(C/N=C(\NCC2CCS(=O)(=O)CC2)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O2S/c1-17-7-9-18(10-8-17)15-22-21(24-20-5-3-2-4-6-20)23-16-19-11-13-27(25,26)14-12-19/h2-10,19H,11-16H2,1H3,(H2,22,23,24) |
| InChIKey | JJVDRHQUFMJSBW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|