C21H28IN3O2S — CID 111722130
2-[(4-methylphenyl)methyl]-1-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-3-phenylguanidine;hydroiodide (PubChem CID 111722130) has the molecular formula C21H28IN3O2S and a molecular weight of 513.45 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-3-phenylguanidine;hydroiodide.
| Compound Name | 2-[(4-methylphenyl)methyl]-1-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-3-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111722130 |
| Molecular Formula | C21H28IN3O2S |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-3-phenylguanidine;hydroiodide |
| SMILES | Cc1ccc(C/N=C(\NCC2(CS(C)(=O)=O)CC2)Nc2ccccc2)cc1.I |
| InChI | InChI=1S/C21H27N3O2S.HI/c1-17-8-10-18(11-9-17)14-22-20(24-19-6-4-3-5-7-19)23-15-21(12-13-21)16-27(2,25)26;/h3-11H,12-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | HYFFLNAEHZNOPV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|