C17H28N4 — CID 134111402
2-(3-amino-2,2-dimethylpropyl)-1-cyclopentyl-3-phenylguanidine (PubChem CID 134111402) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-(3-amino-2,2-dimethylpropyl)-1-cyclopentyl-3-phenylguanidine.
| Compound Name | 2-(3-amino-2,2-dimethylpropyl)-1-cyclopentyl-3-phenylguanidine |
|---|---|
| PubChem CID | 134111402 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-(3-amino-2,2-dimethylpropyl)-1-cyclopentyl-3-phenylguanidine |
| SMILES | CC(C)(CN)C/N=C(/Nc1ccccc1)NC1CCCC1 |
| InChI | InChI=1S/C17H28N4/c1-17(2,12-18)13-19-16(21-15-10-6-7-11-15)20-14-8-4-3-5-9-14/h3-5,8-9,15H,6-7,10-13,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | LGATWQFDHONMLE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|