C20H33N3O — CID 111979093
2-(2,2-dimethyl-3-phenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine (PubChem CID 111979093) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-phenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine.
| Compound Name | 2-(2,2-dimethyl-3-phenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
|---|---|
| PubChem CID | 111979093 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 2-(2,2-dimethyl-3-phenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)Cc1ccccc1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C20H33N3O/c1-4-21-19(23-17-10-12-18(24)13-11-17)22-15-20(2,3)14-16-8-6-5-7-9-16/h5-9,17-18,24H,4,10-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | OXFLUTJCBKGJGM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|