C19H30BrN3O — CID 111190612
2-[2-(4-bromophenyl)-2-methylpropyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine (PubChem CID 111190612) has the molecular formula C19H30BrN3O and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-methylpropyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine.
| Compound Name | 2-[2-(4-bromophenyl)-2-methylpropyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
|---|---|
| PubChem CID | 111190612 |
| Molecular Formula | C19H30BrN3O |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-methylpropyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(Br)cc1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C19H30BrN3O/c1-4-21-18(23-16-9-11-17(24)12-10-16)22-13-19(2,3)14-5-7-15(20)8-6-14/h5-8,16-17,24H,4,9-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | VNZUDNQFEFUQNW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|