C20H31BrIN3O — CID 111189743
2-[[1-(4-bromophenyl)cyclobutyl]methyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide (PubChem CID 111189743) has the molecular formula C20H31BrIN3O and a molecular weight of 536.30 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)cyclobutyl]methyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(4-bromophenyl)cyclobutyl]methyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111189743 |
| Molecular Formula | C20H31BrIN3O |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 2-[[1-(4-bromophenyl)cyclobutyl]methyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(Br)cc2)CCC1)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C20H30BrN3O.HI/c1-2-22-19(24-17-8-10-18(25)11-9-17)23-14-20(12-3-13-20)15-4-6-16(21)7-5-15;/h4-7,17-18,25H,2-3,8-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | JDJKINUAQUPHJV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|