C32H48N4O — CID 69003801
N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(2-cyclohexylethoxy)phenyl]piperidine-1-carboximidamide (PubChem CID 69003801) has the molecular formula C32H48N4O and a molecular weight of 504.76 g/mol. Its IUPAC name is N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(2-cyclohexylethoxy)phenyl]piperidine-1-carboximidamide.
| Compound Name | N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(2-cyclohexylethoxy)phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 69003801 |
| Molecular Formula | C32H48N4O |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(2-cyclohexylethoxy)phenyl]piperidine-1-carboximidamide |
| SMILES | CC(C)(CN)C/N=C(/Nc1ccc(OCCC2CCCCC2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H48N4O/c1-32(2,24-33)25-34-31(36-20-17-28(18-21-36)23-27-11-7-4-8-12-27)35-29-13-15-30(16-14-29)37-22-19-26-9-5-3-6-10-26/h4,7-8,11-16,26,28H,3,5-6,9-10,17-25,33H2,1-2H3,(H,34,35) |
| InChIKey | UHCDFIIVAXOWIL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|