C30H37F9N4O5 — CID 87650171
N'-(3-aminopropyl)-4-benzyl-N-[4-(4,4,4-trifluorobutoxy)phenyl]piperidine-1-carboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87650171) has the molecular formula C30H37F9N4O5 and a molecular weight of 704.63 g/mol. Its IUPAC name is N'-(3-aminopropyl)-4-benzyl-N-[4-(4,4,4-trifluorobutoxy)phenyl]piperidine-1-carboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N'-(3-aminopropyl)-4-benzyl-N-[4-(4,4,4-trifluorobutoxy)phenyl]piperidine-1-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87650171 |
| Molecular Formula | C30H37F9N4O5 |
| Molecular Weight | 704.63 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | N'-(3-aminopropyl)-4-benzyl-N-[4-(4,4,4-trifluorobutoxy)phenyl]piperidine-1-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCCC/N=C(/Nc1ccc(OCCCC(F)(F)F)cc1)N1CCC(Cc2ccccc2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H35F3N4O.2C2HF3O2/c27-26(28,29)14-4-19-34-24-10-8-23(9-11-24)32-25(31-16-5-15-30)33-17-12-22(13-18-33)20-21-6-2-1-3-7-21;2*3-2(4,5)1(6)7/h1-3,6-11,22H,4-5,12-20,30H2,(H,31,32);2*(H,6,7) |
| InChIKey | CHLBGYJJDIFFSR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|