C20H31N5O — CID 69003565
N'-(3-aminopropyl)-N-[4-(3-cyanopropoxy)phenyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 69003565) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N-[4-(3-cyanopropoxy)phenyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-(3-aminopropyl)-N-[4-(3-cyanopropoxy)phenyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 69003565 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | N'-(3-aminopropyl)-N-[4-(3-cyanopropoxy)phenyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(=N\CCCN)Nc2ccc(OCCCC#N)cc2)C1 |
| InChI | InChI=1S/C20H31N5O/c1-17-6-4-14-25(16-17)20(23-13-5-12-22)24-18-7-9-19(10-8-18)26-15-3-2-11-21/h7-10,17H,2-6,12-16,22H2,1H3,(H,23,24) |
| InChIKey | JGVWURILMHKYHQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|