C27H40N4O — CID 69005389
N'-(3-aminopropyl)-4-benzyl-N-(4-pentoxyphenyl)piperidine-1-carboximidamide (PubChem CID 69005389) has the molecular formula C27H40N4O and a molecular weight of 436.64 g/mol. Its IUPAC name is N'-(3-aminopropyl)-4-benzyl-N-(4-pentoxyphenyl)piperidine-1-carboximidamide.
| Compound Name | N'-(3-aminopropyl)-4-benzyl-N-(4-pentoxyphenyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 69005389 |
| Molecular Formula | C27H40N4O |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | N'-(3-aminopropyl)-4-benzyl-N-(4-pentoxyphenyl)piperidine-1-carboximidamide |
| SMILES | CCCCCOc1ccc(N/C(=N/CCCN)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H40N4O/c1-2-3-7-21-32-26-13-11-25(12-14-26)30-27(29-18-8-17-28)31-19-15-24(16-20-31)22-23-9-5-4-6-10-23/h4-6,9-14,24H,2-3,7-8,15-22,28H2,1H3,(H,29,30) |
| InChIKey | SQORUWYNHUWIHA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|