C30H38N4O3S — CID 69000489
N'-(3-aminopropyl)-4-benzyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide (PubChem CID 69000489) has the molecular formula C30H38N4O3S and a molecular weight of 534.73 g/mol. Its IUPAC name is N'-(3-aminopropyl)-4-benzyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide.
| Compound Name | N'-(3-aminopropyl)-4-benzyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 69000489 |
| Molecular Formula | C30H38N4O3S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | N'-(3-aminopropyl)-4-benzyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
| SMILES | CS(=O)(=O)c1ccc(COc2ccc(N/C(=N/CCCN)N3CCC(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H38N4O3S/c1-38(35,36)29-14-8-26(9-15-29)23-37-28-12-10-27(11-13-28)33-30(32-19-5-18-31)34-20-16-25(17-21-34)22-24-6-3-2-4-7-24/h2-4,6-15,25H,5,16-23,31H2,1H3,(H,32,33) |
| InChIKey | SSXCIETYBJCNKI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|