C31H48N4O — CID 68998344
N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(5-methylhexoxy)phenyl]piperidine-1-carboximidamide (PubChem CID 68998344) has the molecular formula C31H48N4O and a molecular weight of 492.75 g/mol. Its IUPAC name is N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(5-methylhexoxy)phenyl]piperidine-1-carboximidamide.
| Compound Name | N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(5-methylhexoxy)phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 68998344 |
| Molecular Formula | C31H48N4O |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | N'-(3-amino-2,2-dimethylpropyl)-4-benzyl-N-[4-(5-methylhexoxy)phenyl]piperidine-1-carboximidamide |
| SMILES | CC(C)CCCCOc1ccc(N/C(=N/CC(C)(C)CN)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H48N4O/c1-25(2)10-8-9-21-36-29-15-13-28(14-16-29)34-30(33-24-31(3,4)23-32)35-19-17-27(18-20-35)22-26-11-6-5-7-12-26/h5-7,11-16,25,27H,8-10,17-24,32H2,1-4H3,(H,33,34) |
| InChIKey | ILJAUDNGKXDUKC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|