C26H46N4O — CID 69003604
N'-(3-aminopropyl)-N-(4-decoxyphenyl)-4-methylpiperidine-1-carboximidamide (PubChem CID 69003604) has the molecular formula C26H46N4O and a molecular weight of 430.68 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N-(4-decoxyphenyl)-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-(3-aminopropyl)-N-(4-decoxyphenyl)-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 69003604 |
| Molecular Formula | C26H46N4O |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | N'-(3-aminopropyl)-N-(4-decoxyphenyl)-4-methylpiperidine-1-carboximidamide |
| SMILES | CCCCCCCCCCOc1ccc(N/C(=N/CCCN)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C26H46N4O/c1-3-4-5-6-7-8-9-10-22-31-25-14-12-24(13-15-25)29-26(28-19-11-18-27)30-20-16-23(2)17-21-30/h12-15,23H,3-11,16-22,27H2,1-2H3,(H,28,29) |
| InChIKey | XXLJXEWJJQZBMJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|