C28H39N3O3 — CID 54830572
N-(4-heptoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide (PubChem CID 54830572) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-(4-heptoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-(4-heptoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54830572 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-(4-heptoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)CNc2ccc(C(=O)N3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H39N3O3/c1-3-4-5-6-7-20-34-26-14-12-25(13-15-26)30-27(32)21-29-24-10-8-23(9-11-24)28(33)31-18-16-22(2)17-19-31/h8-15,22,29H,3-7,16-21H2,1-2H3,(H,30,32) |
| InChIKey | SRYUKOGXWJXJSU-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|