C27H37N3O3 — CID 54830769
N-(3-hexoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide (PubChem CID 54830769) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is N-(3-hexoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-(3-hexoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54830769 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | N-(3-hexoxyphenyl)-2-[4-(4-methylpiperidine-1-carbonyl)anilino]acetamide |
| SMILES | CCCCCCOc1cccc(NC(=O)CNc2ccc(C(=O)N3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C27H37N3O3/c1-3-4-5-6-18-33-25-9-7-8-24(19-25)29-26(31)20-28-23-12-10-22(11-13-23)27(32)30-16-14-21(2)15-17-30/h7-13,19,21,28H,3-6,14-18,20H2,1-2H3,(H,29,31) |
| InChIKey | QSTZMOPOGQXOBK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|