C26H28N2O4S — CID 45375503
4-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]-N-phenylbenzenesulfonamide (PubChem CID 45375503) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]-N-phenylbenzenesulfonamide.
| Compound Name | 4-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 45375503 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]-N-phenylbenzenesulfonamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)Nc2ccccc2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N2O4S/c29-26(28-17-15-22(16-18-28)19-21-7-3-1-4-8-21)20-32-24-11-13-25(14-12-24)33(30,31)27-23-9-5-2-6-10-23/h1-14,22,27H,15-20H2 |
| InChIKey | VGHWEAVABKVOFA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |