C29H31F3N2O7S — CID 146054962
2-(4-benzylpiperidin-1-yl)-5-[(4-ethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146054962) has the molecular formula C29H31F3N2O7S and a molecular weight of 608.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-ethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-ethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146054962 |
| Molecular Formula | C29H31F3N2O7S |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-ethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)O)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H30N2O5S.C2HF3O2/c1-2-34-23-9-11-24(12-10-23)35(32,33)28-22-8-13-26(25(19-22)27(30)31)29-16-14-21(15-17-29)18-20-6-4-3-5-7-20;3-2(4,5)1(6)7/h3-13,19,21,28H,2,14-18H2,1H3,(H,30,31);(H,6,7) |
| InChIKey | POKQNNQSERGKSM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|