C27H30N2O5S — CID 46325369
5-(4-benzylpiperidin-1-yl)-2-[(4-ethoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 46325369) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 5-(4-benzylpiperidin-1-yl)-2-[(4-ethoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 5-(4-benzylpiperidin-1-yl)-2-[(4-ethoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46325369 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 5-(4-benzylpiperidin-1-yl)-2-[(4-ethoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-2-34-23-9-11-24(12-10-23)35(32,33)28-26-13-8-22(19-25(26)27(30)31)29-16-14-21(15-17-29)18-20-6-4-3-5-7-20/h3-13,19,21,28H,2,14-18H2,1H3,(H,30,31) |
| InChIKey | ZDYODDNHCJBEIF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |