C28H32N2O4S — CID 46325331
5-(4-benzylpiperidin-1-yl)-2-[(4-propan-2-ylphenyl)sulfonylamino]benzoic acid (PubChem CID 46325331) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is 5-(4-benzylpiperidin-1-yl)-2-[(4-propan-2-ylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 5-(4-benzylpiperidin-1-yl)-2-[(4-propan-2-ylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46325331 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 5-(4-benzylpiperidin-1-yl)-2-[(4-propan-2-ylphenyl)sulfonylamino]benzoic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H32N2O4S/c1-20(2)23-8-11-25(12-9-23)35(33,34)29-27-13-10-24(19-26(27)28(31)32)30-16-14-22(15-17-30)18-21-6-4-3-5-7-21/h3-13,19-20,22,29H,14-18H2,1-2H3,(H,31,32) |
| InChIKey | YDKPMOQNYUESHK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |