C23H30N2O4S — CID 46325342
5-(azepan-1-yl)-2-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 46325342) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 5-(azepan-1-yl)-2-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 5-(azepan-1-yl)-2-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46325342 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5-(azepan-1-yl)-2-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | CC(C)Cc1ccc(S(=O)(=O)Nc2ccc(N3CCCCCC3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-17(2)15-18-7-10-20(11-8-18)30(28,29)24-22-12-9-19(16-21(22)23(26)27)25-13-5-3-4-6-14-25/h7-12,16-17,24H,3-6,13-15H2,1-2H3,(H,26,27) |
| InChIKey | AJSPRLZISXRURI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |