C25H29ClF3N3O6 — CID 18322559
3-[3-(4-benzylpiperidine-1-carbonyl)-5-chlorophenoxy]propoxyurea;2,2,2-trifluoroacetic acid (PubChem CID 18322559) has the molecular formula C25H29ClF3N3O6 and a molecular weight of 559.97 g/mol. Its IUPAC name is 3-[3-(4-benzylpiperidine-1-carbonyl)-5-chlorophenoxy]propoxyurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-(4-benzylpiperidine-1-carbonyl)-5-chlorophenoxy]propoxyurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18322559 |
| Molecular Formula | C25H29ClF3N3O6 |
| Molecular Weight | 559.97 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 3-[3-(4-benzylpiperidine-1-carbonyl)-5-chlorophenoxy]propoxyurea;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)NOCCCOc1cc(Cl)cc(C(=O)N2CCC(Cc3ccccc3)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28ClN3O4.C2HF3O2/c24-20-14-19(15-21(16-20)30-11-4-12-31-26-23(25)29)22(28)27-9-7-18(8-10-27)13-17-5-2-1-3-6-17;3-2(4,5)1(6)7/h1-3,5-6,14-16,18H,4,7-13H2,(H3,25,26,29);(H,6,7) |
| InChIKey | GHJIXPYPMMRLBX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|