C19H26F6N4 — CID 134099414
2-(3-amino-2,2-dimethylpropyl)-1-[3,5-bis(trifluoromethyl)phenyl]-3-cyclopentylguanidine (PubChem CID 134099414) has the molecular formula C19H26F6N4 and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-(3-amino-2,2-dimethylpropyl)-1-[3,5-bis(trifluoromethyl)phenyl]-3-cyclopentylguanidine.
| Compound Name | 2-(3-amino-2,2-dimethylpropyl)-1-[3,5-bis(trifluoromethyl)phenyl]-3-cyclopentylguanidine |
|---|---|
| PubChem CID | 134099414 |
| Molecular Formula | C19H26F6N4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-(3-amino-2,2-dimethylpropyl)-1-[3,5-bis(trifluoromethyl)phenyl]-3-cyclopentylguanidine |
| SMILES | CC(C)(CN)C/N=C(/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC1CCCC1 |
| InChI | InChI=1S/C19H26F6N4/c1-17(2,10-26)11-27-16(28-14-5-3-4-6-14)29-15-8-12(18(20,21)22)7-13(9-15)19(23,24)25/h7-9,14H,3-6,10-11,26H2,1-2H3,(H2,27,28,29) |
| InChIKey | SYXSKNOKTCJFHJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|