C20H28F6N4 — CID 134099520
1-[(1S,2S)-2-aminocyclohexyl]-3-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2-dimethylpropyl)guanidine (PubChem CID 134099520) has the molecular formula C20H28F6N4 and a molecular weight of 438.46 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclohexyl]-3-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2-dimethylpropyl)guanidine.
| Compound Name | 1-[(1S,2S)-2-aminocyclohexyl]-3-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2-dimethylpropyl)guanidine |
|---|---|
| PubChem CID | 134099520 |
| Molecular Formula | C20H28F6N4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclohexyl]-3-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2-dimethylpropyl)guanidine |
| SMILES | CC(C)(C)C/N=C(/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N[C@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C20H28F6N4/c1-18(2,3)11-28-17(30-16-7-5-4-6-15(16)27)29-14-9-12(19(21,22)23)8-13(10-14)20(24,25)26/h8-10,15-16H,4-7,11,27H2,1-3H3,(H2,28,29,30)/t15-,16-/m0/s1 |
| InChIKey | RAEQGWYZODRYHR-HOTGVXAUSA-N |
| XLogP | 5.40 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|