C23H24F6N4O2 — CID 134099515
1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-bis(trifluoromethyl)phenyl]guanidine (PubChem CID 134099515) has the molecular formula C23H24F6N4O2 and a molecular weight of 502.46 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-bis(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-bis(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 134099515 |
| Molecular Formula | C23H24F6N4O2 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-bis(trifluoromethyl)phenyl]guanidine |
| SMILES | N[C@H]1CCCC[C@@H]1N/C(=N\Cc1ccc2c(c1)OCO2)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F6N4O2/c24-22(25,26)14-8-15(23(27,28)29)10-16(9-14)32-21(33-18-4-2-1-3-17(18)30)31-11-13-5-6-19-20(7-13)35-12-34-19/h5-10,17-18H,1-4,11-12,30H2,(H2,31,32,33)/t17-,18-/m0/s1 |
| InChIKey | SPFJSXLYQXHICN-ROUUACIJSA-N |
| XLogP | 5.28 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|