C22H28N4O2S — CID 134088999
1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-(2-methylsulfanylphenyl)guanidine (PubChem CID 134088999) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-(2-methylsulfanylphenyl)guanidine.
| Compound Name | 1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-(2-methylsulfanylphenyl)guanidine |
|---|---|
| PubChem CID | 134088999 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-(2-methylsulfanylphenyl)guanidine |
| SMILES | CSc1ccccc1N/C(=N\Cc1ccc2c(c1)OCO2)N[C@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C22H28N4O2S/c1-29-21-9-5-4-8-18(21)26-22(25-17-7-3-2-6-16(17)23)24-13-15-10-11-19-20(12-15)28-14-27-19/h4-5,8-12,16-17H,2-3,6-7,13-14,23H2,1H3,(H2,24,25,26)/t16-,17-/m0/s1 |
| InChIKey | ONCMWXPBDGGMCX-IRXDYDNUSA-N |
| XLogP | 3.96 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|