C18H31N5 — CID 134088933
2-(3-amino-2,2-dimethylpropyl)-1-(cyclohexylmethyl)-3-pyridin-3-ylguanidine (PubChem CID 134088933) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-(3-amino-2,2-dimethylpropyl)-1-(cyclohexylmethyl)-3-pyridin-3-ylguanidine.
| Compound Name | 2-(3-amino-2,2-dimethylpropyl)-1-(cyclohexylmethyl)-3-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 134088933 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 2-(3-amino-2,2-dimethylpropyl)-1-(cyclohexylmethyl)-3-pyridin-3-ylguanidine |
| SMILES | CC(C)(CN)C/N=C(\NCC1CCCCC1)Nc1cccnc1 |
| InChI | InChI=1S/C18H31N5/c1-18(2,13-19)14-22-17(23-16-9-6-10-20-12-16)21-11-15-7-4-3-5-8-15/h6,9-10,12,15H,3-5,7-8,11,13-14,19H2,1-2H3,(H2,21,22,23) |
| InChIKey | SLTSMMOAMIIQAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|