C18H30IN5O — CID 111608771
2-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111608771) has the molecular formula C18H30IN5O and a molecular weight of 459.38 g/mol. Its IUPAC name is 2-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111608771 |
| Molecular Formula | C18H30IN5O |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | C/N=C(\NCCCCC1CCCC1)NCC(=O)Nc1cccnc1.I |
| InChI | InChI=1S/C18H29N5O.HI/c1-19-18(21-12-5-4-9-15-7-2-3-8-15)22-14-17(24)23-16-10-6-11-20-13-16;/h6,10-11,13,15H,2-5,7-9,12,14H2,1H3,(H,23,24)(H2,19,21,22);1H |
| InChIKey | NBOLDZHDSHYKFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|