C16H21N5OS — CID 111957367
2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide (PubChem CID 111957367) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111957367 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide |
| SMILES | CCc1ccc(CN/C(=N\C)NCC(=O)Nc2cccnc2)s1 |
| InChI | InChI=1S/C16H21N5OS/c1-3-13-6-7-14(23-13)10-19-16(17-2)20-11-15(22)21-12-5-4-8-18-9-12/h4-9H,3,10-11H2,1-2H3,(H,21,22)(H2,17,19,20) |
| InChIKey | JCDDKYNDUWSSFH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|