C17H21FN4OS — CID 111956737
2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 111956737) has the molecular formula C17H21FN4OS and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111956737 |
| Molecular Formula | C17H21FN4OS |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | CCc1ccc(CN/C(=N\C)NCC(=O)Nc2cccc(F)c2)s1 |
| InChI | InChI=1S/C17H21FN4OS/c1-3-14-7-8-15(24-14)10-20-17(19-2)21-11-16(23)22-13-6-4-5-12(18)9-13/h4-9H,3,10-11H2,1-2H3,(H,22,23)(H2,19,20,21) |
| InChIKey | BPVQVPUYCBQFSU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|