C14H22FIN4O — CID 110965527
2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 110965527) has the molecular formula C14H22FIN4O and a molecular weight of 408.26 g/mol. Its IUPAC name is 2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110965527 |
| Molecular Formula | C14H22FIN4O |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1cccc(F)c1)NC(C)(C)C.I |
| InChI | InChI=1S/C14H21FN4O.HI/c1-14(2,3)19-13(16-4)17-9-12(20)18-11-7-5-6-10(15)8-11;/h5-8H,9H2,1-4H3,(H,18,20)(H2,16,17,19);1H |
| InChIKey | HEFWQYSRVVQOSV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|