C15H24FIN4O — CID 110977956
N-(3-fluorophenyl)-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 110977956) has the molecular formula C15H24FIN4O and a molecular weight of 422.29 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(3-fluorophenyl)-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110977956 |
| Molecular Formula | C15H24FIN4O |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-(3-fluorophenyl)-2-[[N'-methyl-N-(3-methylbutyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCC(C)C)NCC(=O)Nc1cccc(F)c1.I |
| InChI | InChI=1S/C15H23FN4O.HI/c1-11(2)7-8-18-15(17-3)19-10-14(21)20-13-6-4-5-12(16)9-13;/h4-6,9,11H,7-8,10H2,1-3H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | WVXPIDCMLCCOCW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|