C17H26FN5O — CID 111416777
N-(3-fluorophenyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 111416777) has the molecular formula C17H26FN5O and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111416777 |
| Molecular Formula | C17H26FN5O |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-(3-fluorophenyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCCN1CCCCC1)NCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H26FN5O/c1-19-17(20-8-11-23-9-3-2-4-10-23)21-13-16(24)22-15-7-5-6-14(18)12-15/h5-7,12H,2-4,8-11,13H2,1H3,(H,22,24)(H2,19,20,21) |
| InChIKey | KVSGFBBNCUTRCH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|