C17H28N4OS — CID 111956745
N-cyclohexyl-2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111956745) has the molecular formula C17H28N4OS and a molecular weight of 336.50 g/mol. Its IUPAC name is N-cyclohexyl-2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111956745 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-cyclohexyl-2-[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | CCc1ccc(CN/C(=N\C)NCC(=O)NC2CCCCC2)s1 |
| InChI | InChI=1S/C17H28N4OS/c1-3-14-9-10-15(23-14)11-19-17(18-2)20-12-16(22)21-13-7-5-4-6-8-13/h9-10,13H,3-8,11-12H2,1-2H3,(H,21,22)(H2,18,19,20) |
| InChIKey | BZYDDMZATUGPTB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|