C16H26N4OS — CID 111892647
N-cyclohexyl-2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111892647) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N-cyclohexyl-2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111892647 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-cyclohexyl-2-[[N'-methyl-N-[(3-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCC(=O)NC1CCCCC1)NCc1sccc1C |
| InChI | InChI=1S/C16H26N4OS/c1-12-8-9-22-14(12)10-18-16(17-2)19-11-15(21)20-13-6-4-3-5-7-13/h8-9,13H,3-7,10-11H2,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | FZGIQYXCWNRUBG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|