C13H21N5OS — CID 119163267
N-cyclopropyl-2-[[N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 119163267) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[[N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[[N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 119163267 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-cyclopropyl-2-[[N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC1CC1)NCc1sc(C)nc1C |
| InChI | InChI=1S/C13H21N5OS/c1-8-11(20-9(2)17-8)6-15-13(14-3)16-7-12(19)18-10-4-5-10/h10H,4-7H2,1-3H3,(H,18,19)(H2,14,15,16) |
| InChIKey | CJVHFDGLQPZJPN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|