C21H25BrFN3O — CID 134088742
2-[(5-bromo-2-fluorophenyl)methyl]-1-(cyclohexylmethyl)-3-(3-hydroxyphenyl)guanidine (PubChem CID 134088742) has the molecular formula C21H25BrFN3O and a molecular weight of 434.35 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-1-(cyclohexylmethyl)-3-(3-hydroxyphenyl)guanidine.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-(cyclohexylmethyl)-3-(3-hydroxyphenyl)guanidine |
|---|---|
| PubChem CID | 134088742 |
| Molecular Formula | C21H25BrFN3O |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-1-(cyclohexylmethyl)-3-(3-hydroxyphenyl)guanidine |
| SMILES | Oc1cccc(N/C(=N/Cc2cc(Br)ccc2F)NCC2CCCCC2)c1 |
| InChI | InChI=1S/C21H25BrFN3O/c22-17-9-10-20(23)16(11-17)14-25-21(24-13-15-5-2-1-3-6-15)26-18-7-4-8-19(27)12-18/h4,7-12,15,27H,1-3,5-6,13-14H2,(H2,24,25,26) |
| InChIKey | BTRIYXYWSIEWNE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|