C17H24BrFN2O — CID 55848861
2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-N-(cyclohexylmethyl)acetamide (PubChem CID 55848861) has the molecular formula C17H24BrFN2O and a molecular weight of 371.29 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 55848861 |
| Molecular Formula | C17H24BrFN2O |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-N-(cyclohexylmethyl)acetamide |
| SMILES | CN(CC(=O)NCC1CCCCC1)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C17H24BrFN2O/c1-21(11-14-9-15(18)7-8-16(14)19)12-17(22)20-10-13-5-3-2-4-6-13/h7-9,13H,2-6,10-12H2,1H3,(H,20,22) |
| InChIKey | ADCXXMPJSVRROU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |