C15H20ClFN2S — CID 42645366
1-(3-chloro-4-fluorophenyl)-3-[(1S)-1-cyclohexylethyl]thiourea (PubChem CID 42645366) has the molecular formula C15H20ClFN2S and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(1S)-1-cyclohexylethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(1S)-1-cyclohexylethyl]thiourea |
|---|---|
| PubChem CID | 42645366 |
| Molecular Formula | C15H20ClFN2S |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(1S)-1-cyclohexylethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(F)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H20ClFN2S/c1-10(11-5-3-2-4-6-11)18-15(20)19-12-7-8-14(17)13(16)9-12/h7-11H,2-6H2,1H3,(H2,18,19,20)/t10-/m0/s1 |
| InChIKey | KWSXFGKNNGOVES-JTQLQIEISA-N |
| XLogP | 4.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|