C22H34FN5 — CID 134091917
N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide (PubChem CID 134091917) has the molecular formula C22H34FN5 and a molecular weight of 387.55 g/mol. Its IUPAC name is N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide.
| Compound Name | N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134091917 |
| Molecular Formula | C22H34FN5 |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide |
| SMILES | N[C@H]1CCCC[C@@H]1/N=C(/Nc1cccc(F)c1)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C22H34FN5/c23-17-6-5-7-18(16-17)25-22(26-21-9-2-1-8-20(21)24)28-14-10-19(11-15-28)27-12-3-4-13-27/h5-7,16,19-21H,1-4,8-15,24H2,(H,25,26)/t20-,21-/m0/s1 |
| InChIKey | DDLSVPCJSXGBCI-SFTDATJTSA-N |
| XLogP | 3.42 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|